CAS 1001648-75-4
:2,6-Diamino-4,5,6,7-tetrahydro-7-benzothiazolol
Description:
2,6-Diamino-4,5,6,7-tetrahydro-7-benzothiazolol, identified by its CAS number 1001648-75-4, is a chemical compound characterized by its unique bicyclic structure that incorporates both a benzothiazole moiety and multiple amino groups. This compound typically exhibits properties such as solubility in polar solvents, which is common for amine-containing compounds, and it may display basicity due to the presence of amino groups. The bicyclic nature of the molecule contributes to its potential biological activity, making it of interest in medicinal chemistry. Its structural features suggest that it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. Additionally, compounds with similar structures often have applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific safety and handling information should be consulted from material safety data sheets (MSDS) or relevant literature, as the biological effects and toxicity profiles can vary significantly among related compounds.
Formula:C7H11N3OS
InChI:InChI=1S/C7H11N3OS/c8-3-1-2-4-6(5(3)11)12-7(9)10-4/h3,5,11H,1-2,8H2,(H2,9,10)
InChI key:InChIKey=OXZALVQILJSBEV-UHFFFAOYSA-N
SMILES:OC1C2=C(N=C(N)S2)CCC1N
Synonyms:- 2,6-Diamino-4,5,6,7-tetrahydro-7-benzothiazolol
- 7-Benzothiazolol, 2,6-diamino-4,5,6,7-tetrahydro-
- 2,6-Diamino-7-hydroxy-4,5,6,7-tetrahydrobenzothiazole
- 2,6-Diamino-4,5,6,7-tetrahydrobenzo[d]thiazol-7-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
