CAS 1001671-64-2

7-Ethenyl-2,3-dihydrobenzofuran

Description:

7-Ethenyl-2,3-dihydrobenzofuran is an organic compound characterized by its unique bicyclic structure, which consists of a benzofuran moiety with an ethenyl group at the 7-position. This compound features a fused benzene and furan ring, contributing to its aromatic properties and potential reactivity. The presence of the ethenyl group introduces unsaturation, which can enhance its reactivity in various chemical reactions, such as polymerization or electrophilic addition. The compound is likely to exhibit moderate polarity due to the presence of the ether-like furan ring, influencing its solubility in organic solvents. Additionally, its structural features may impart interesting biological activities, making it a candidate for further research in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as the compound may pose risks such as flammability or toxicity. Overall, 7-Ethenyl-2,3-dihydrobenzofuran represents a fascinating subject for study in organic synthesis and potential applications in pharmaceuticals or materials science.

Formula: C₁₀H₁₀O

InChI: InChI=1S/C10H10O/c1-2-8-4-3-5-9-6-7-11-10(8)9/h2-5H,1,6-7H2

InChI key: InChIKey=DZJFYXILEDKABQ-UHFFFAOYSA-N

SMILES: C(=C)C1=C2C(CCO2)=CC=C1

Synonyms:

• 7-Ethenyl-2,3-dihydrobenzofuran
• Benzofuran, 7-ethenyl-2,3-dihydro-