CAS 10017-04-6
:(R)-(+)-4-methylmandelonitrile
Description:
(R)-(+)-4-methylmandelonitrile is a chiral organic compound characterized by its specific stereochemistry and functional groups. It features a nitrile group (-C≡N) attached to a mandelic acid derivative, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methyl group at the 4-position of the mandelonitrile structure influences its physical properties, such as solubility and boiling point, and can affect its interaction with biological systems, making it of interest in pharmaceutical chemistry. The compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. Its chirality is significant in the context of enantioselective reactions, where the (R)-enantiomer may exhibit different biological activity compared to its (S)-counterpart. As with many nitriles, it may also participate in nucleophilic addition reactions, making it a valuable intermediate in the synthesis of various organic compounds. Safety precautions should be observed when handling this substance due to its potential toxicity and reactivity.
Formula:C9H9NO
InChI:InChI=1/C9H9NO/c1-7-2-4-8(5-3-7)9(11)6-10/h2-5,9,11H,1H3/t9-/m0/s1
SMILES:Cc1ccc(cc1)[C@H](C#N)O
Synonyms:- (2R)-hydroxy(4-methylphenyl)ethanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
