CAS 1001754-73-9
:4-[4-(4-Piperidinyl)-2-pyrimidinyl]morpholine
Description:
4-[4-(4-Piperidinyl)-2-pyrimidinyl]morpholine, with the CAS number 1001754-73-9, is a chemical compound characterized by its complex structure, which includes a morpholine ring and a pyrimidine moiety substituted with a piperidine group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. Its molecular structure suggests it may engage in hydrogen bonding due to the presence of nitrogen atoms in both the piperidine and morpholine rings, which can influence its reactivity and interaction with biological targets. The compound may possess pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Additionally, its specific functional groups may contribute to its lipophilicity and ability to cross biological membranes. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory settings.
Formula:C13H20N4O
InChI:InChI=1S/C13H20N4O/c1-4-14-5-2-11(1)12-3-6-15-13(16-12)17-7-9-18-10-8-17/h3,6,11,14H,1-2,4-5,7-10H2
InChI key:InChIKey=MJMZIXACXYXODP-UHFFFAOYSA-N
SMILES:C1(=NC(=NC=C1)N2CCOCC2)C3CCNCC3
Synonyms:- 4-[4-(4-Piperidinyl)-2-pyrimidinyl]morpholine
- Morpholine, 4-[4-(4-piperidinyl)-2-pyrimidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
