CymitQuimica logo

CAS 1001755-77-6

:

1-Ethyl-4-nitro-1H-pyrazole-3-carboxylic acid hydrazide

Description:
1-Ethyl-4-nitro-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an ethyl group and a nitro group, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the carboxylic acid and hydrazide functional groups indicates that it may participate in various chemical reactions, such as condensation and hydrazone formation. The compound's hydrophilicity is influenced by the carboxylic acid group, while the nitro group can enhance its electron-withdrawing properties, affecting its overall reactivity. Additionally, the compound may exhibit biological activity, making it of interest for research in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks or environmental hazards. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C6H9N5O3
InChI:InChI=1S/C6H9N5O3/c1-2-10-3-4(11(13)14)5(9-10)6(12)8-7/h3H,2,7H2,1H3,(H,8,12)
InChI key:InChIKey=YJIARCRRZCGUNL-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C(N(=O)=O)=CN(CC)N1
Synonyms:
  • 1-Ethyl-4-nitro-1H-pyrazole-3-carboxylic acid hydrazide
  • 1H-Pyrazole-3-carboxylic acid, 1-ethyl-4-nitro-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.