CymitQuimica logo

CAS 1001755-78-7

:

4-Chloro-3,4-dihydro-6,7-dimethoxyquinazoline

Description:
4-Chloro-3,4-dihydro-6,7-dimethoxyquinazoline is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This specific compound features a chlorine atom at the 4-position and two methoxy groups at the 6 and 7 positions, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chloro and methoxy substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry for potential therapeutic applications. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C10H11ClN2O2
InChI:InChI=1S/C10H11ClN2O2/c1-14-8-3-6-7(4-9(8)15-2)12-5-13-10(6)11/h3-5,10H,1-2H3,(H,12,13)
InChI key:InChIKey=TWXJHODVGPSXCO-UHFFFAOYSA-N
SMILES:ClC1C=2C(=CC(OC)=C(OC)C2)NC=N1
Synonyms:
  • Quinazoline, 4-chloro-3,4-dihydro-6,7-dimethoxy-
  • 4-Chloro-3,4-dihydro-6,7-dimethoxyquinazoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.