CAS 1001755-86-7

4-Chloro-1-ethyl-1H-pyrazole-3-carboxylic acid hydrazide

Description:

4-Chloro-1-ethyl-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a chloro substituent at the 4-position and an ethyl group at the 1-position of the pyrazole ring, contributing to its unique reactivity and properties. The presence of the carboxylic acid hydrazide functional group enhances its potential for forming hydrogen bonds, making it a candidate for various biological activities. It is typically used in research and development, particularly in the fields of pharmaceuticals and agrochemicals, due to its potential as a building block for more complex molecules. The compound's solubility, stability, and reactivity can vary depending on the solvent and conditions, which are important considerations for its application in synthesis and biological assays. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₆H₉ClN₄O

InChI: InChI=1S/C6H9ClN4O/c1-2-11-3-4(7)5(10-11)6(12)9-8/h3H,2,8H2,1H3,(H,9,12)

InChI key: InChIKey=CDRZACDRGNPHPZ-UHFFFAOYSA-N

SMILES: C(NN)(=O)C=1C(Cl)=CN(CC)N1

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 4-chloro-1-ethyl-, hydrazide
• 4-Chloro-1-ethyl-1H-pyrazole-3-carboxylic acid hydrazide

4-Chloro-1-ethyl-1H-pyrazole-3-carbohydrazide

CAS: 1001755-86-7

Versatile small molecule scaffold

Formula: C₆H₉ClN₄O

Purity: Min. 95%

Molecular weight: 188.61 g/mol

Ref: 3D-BQB75586