CAS 1001757-40-9
:3-[(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide
Description:
3-[(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety linked to a hydrazide functional group. The presence of a pyrazole ring, substituted with bromine and methyl groups, contributes to its unique chemical properties and potential biological activity. This compound may exhibit various characteristics such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity due to the hydrazide functional group, which can participate in condensation reactions. The bromine substituent may enhance its lipophilicity and influence its interaction with biological targets. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both hydrazide and pyrazole functionalities, which are often associated with bioactive compounds. However, specific physical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C13H15BrN4O
InChI:InChI=1S/C13H15BrN4O/c1-8-12(14)9(2)18(17-8)7-10-4-3-5-11(6-10)13(19)16-15/h3-6H,7,15H2,1-2H3,(H,16,19)
InChI key:InChIKey=BIKOKRJNAQVPRA-UHFFFAOYSA-N
SMILES:C(N1C(C)=C(Br)C(C)=N1)C2=CC(C(NN)=O)=CC=C2
Synonyms:- 3-[(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide
- Benzoic acid, 3-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.