
CAS 1001757-45-4
:1-[(1-Methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-4-amine
Description:
1-[(1-Methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-4-amine, identified by its CAS number 1001757-45-4, is a chemical compound characterized by its pyrazole core structure, which consists of two pyrazole rings connected by a methylene bridge. This compound typically exhibits properties associated with heterocyclic amines, including potential biological activity due to the presence of nitrogen atoms in its structure. It may display solubility in polar solvents, and its reactivity can be influenced by the functional groups present, particularly the amine and methyl substituents. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrazole derivatives are often explored for their anti-inflammatory, analgesic, and antitumor properties. Additionally, the presence of the methyl group may enhance lipophilicity, affecting its pharmacokinetic profile. Overall, this compound represents a class of substances that are of interest in both synthetic and medicinal chemistry.
Formula:C8H11N5
InChI:InChI=1S/C8H11N5/c1-12-4-7(2-10-12)5-13-6-8(9)3-11-13/h2-4,6H,5,9H2,1H3
InChI key:InChIKey=YLLLSNVYMVTPSS-UHFFFAOYSA-N
SMILES:C(C=1C=NN(C)C1)N2N=CC(N)=C2
Synonyms:- 1H-Pyrazol-4-amine, 1-[(1-methyl-1H-pyrazol-4-yl)methyl]-
- 1-[(1-Methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.