CAS 1001757-56-7: 4-Bromo-1-[(2-fluorophenyl)methyl]-1H-pyrazol-3-amine

Description: 4-Bromo-1-[(2-fluorophenyl)methyl]-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a 2-fluorophenylmethyl group at the 1-position contributes to its unique reactivity and potential biological activity. This compound is typically classified as an organic heterocyclic compound and may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets due to its functional groups. The fluorine atom can enhance lipophilicity and influence the compound's pharmacokinetic properties. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific pathways or diseases. As with many pyrazole derivatives, it may also exhibit anti-inflammatory, analgesic, or anticancer activities, although specific biological data would be necessary to confirm these effects. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₉BrFN₃

InChI: InChI=1S/C10H9BrFN3/c11-8-6-15(14-10(8)13)5-7-3-1-2-4-9(7)12/h1-4,6H,5H2,(H2,13,14)

InChI key: InChIKey=QFZUXIIBOIRIPL-UHFFFAOYSA-N

SMILES: FC=1C=CC=CC1CN2N=C(N)C(Br)=C2

Synonyms:

• 4-Bromo-1-[(2-fluorophenyl)methyl]-1H-pyrazol-3-amine
• 1H-Pyrazol-3-amine, 4-bromo-1-[(2-fluorophenyl)methyl]-

4-Bromo-1-(2-fluorobenzyl)-1H-pyrazol-3-amine

CAS: 1001757-56-7

• Molecular weight: 270.10g/mol

4-Bromo-1-[(2-fluorophenyl)methyl]-1H-pyrazol-3-amine

CAS: 1001757-56-7

Versatile small molecule scaffold

• Formula: C₁₀H₉BrFN₃
• Purity: Min. 95%
• Molecular weight: 270.1 g/mol

4-Bromo-1-(2-fluoro-benzyl)-1 H -pyrazol-3-ylamine

CAS: 1001757-56-7

• Molecular weight: 270.1050109863281