CymitQuimica logo

CAS 1001757-59-0

:

1-[(1-Methyl-1H-pyrazol-4-yl)methyl]piperazine

Description:
1-[(1-Methyl-1H-pyrazol-4-yl)methyl]piperazine, identified by its CAS number 1001757-59-0, is a chemical compound characterized by its unique structural features. It consists of a piperazine ring, which is a six-membered cyclic amine, linked to a 1-methyl-1H-pyrazole moiety through a methylene bridge. This compound exhibits properties typical of piperazine derivatives, including potential biological activity, making it of interest in medicinal chemistry. The presence of the pyrazole ring may contribute to its pharmacological properties, as pyrazoles are known for their diverse biological activities, including anti-inflammatory and analgesic effects. The compound is likely to be soluble in polar solvents due to the presence of nitrogen atoms in both the piperazine and pyrazole rings, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in drug development, particularly in targeting specific receptors or enzymes. However, detailed studies on its toxicity, stability, and specific biological interactions would be necessary to fully understand its potential uses and safety profile.
Formula:C9H16N4
InChI:InChI=1S/C9H16N4/c1-12-7-9(6-11-12)8-13-4-2-10-3-5-13/h6-7,10H,2-5,8H2,1H3
InChI key:InChIKey=QQINQSPEYDVMCD-UHFFFAOYSA-N
SMILES:C(C=1C=NN(C)C1)N2CCNCC2
Synonyms:
  • 1-[(1-Methylpyrazol-4-yl)methyl]piperazine
  • Piperazine, 1-[(1-methyl-1H-pyrazol-4-yl)methyl]-
  • 1-[(1-Methyl-1H-pyrazol-4-yl)methyl]piperazine
Found 1 products.