
CAS 100181-71-3
:2-Methylpropyl 2-oxiraneacetate
Description:
2-Methylpropyl 2-oxiraneacetate, also known as isobutyl glycidyl ether, is an organic compound characterized by its epoxide functional group, which contributes to its reactivity and utility in various chemical applications. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the epoxide group makes it susceptible to nucleophilic attack, allowing it to participate in ring-opening reactions, which are valuable in polymer chemistry and the synthesis of various derivatives. Additionally, 2-Methylpropyl 2-oxiraneacetate is often used as a reactive diluent in epoxy formulations, enhancing the properties of the final product. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause skin and eye irritation. Overall, its unique structure and reactivity make it a significant compound in industrial applications, particularly in the production of coatings, adhesives, and sealants.
Formula:C8H14O3
InChI:InChI=1S/C8H14O3/c1-6(2)4-11-8(9)3-7-5-10-7/h6-7H,3-5H2,1-2H3
InChI key:InChIKey=KLQCEQLRGRMLBI-UHFFFAOYSA-N
SMILES:C(C(OCC(C)C)=O)C1CO1
Synonyms:- 2-Oxiraneacetic acid, 2-methylpropyl ester
- 2-Methylpropyl 3,4-epoxybutanoate
- 2-Methylpropyl 2-oxiraneacetate
- Isobutyl 3,4-epoxybutyrate
- Oxiraneacetic acid, 2-methylpropyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
