CymitQuimica logo

CAS 100187-11-9

:

Ethyl 3-ethyl-1H-1,2,4-triazole-5-acetate

Description:
Ethyl 3-ethyl-1H-1,2,4-triazole-5-acetate is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically exhibits properties associated with triazoles, such as potential antifungal and agricultural applications. The presence of the ethyl and acetate groups contributes to its solubility and reactivity, making it useful in various chemical reactions. The compound's molecular structure allows for interactions with biological systems, which can be leveraged in pharmaceutical and agrochemical formulations. Additionally, its CAS number, 100187-11-9, serves as a unique identifier for regulatory and safety information. As with many triazole derivatives, it may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization in laboratory settings. Overall, Ethyl 3-ethyl-1H-1,2,4-triazole-5-acetate is a versatile compound with potential applications in multiple fields, including medicine and agriculture.
Formula:C8H13N3O2
InChI:InChI=1S/C8H13N3O2/c1-3-6-9-7(11-10-6)5-8(12)13-4-2/h3-5H2,1-2H3,(H,9,10,11)
InChI key:InChIKey=JBLLRJXYCKYPII-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)C=1NC(CC)=NN1
Synonyms:
  • Ethyl 3-ethyl-1H-1,2,4-triazole-5-acetate
  • 1H-1,2,4-Triazole-3-acetic acid, 5-ethyl-, ethyl ester
  • 1H-1,2,4-Triazole-5-acetic acid, 3-ethyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.