CymitQuimica logo

CAS 100188-45-2

:

2-Azetidinecarboxylic acid, 4-oxo-1-(trimethylsilyl)-, methyl ester, (S)-

Description:
2-Azetidinecarboxylic acid, 4-oxo-1-(trimethylsilyl)-, methyl ester, (S)-, with CAS number 100188-45-2, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a carboxylic acid functional group and a methyl ester, indicating it can undergo hydrolysis to release methanol and form the corresponding acid. The presence of a trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. The (S)- designation indicates that it has a specific stereochemistry, which can influence its reactivity and interaction with biological systems. This compound may be of interest in pharmaceutical chemistry and organic synthesis due to its potential as a building block for more complex molecules. Its unique structural features contribute to its chemical reactivity, making it a valuable compound in research and development within the field of medicinal chemistry.
Formula:C8H15NO3Si
InChI:InChI=1S/C8H15NO3Si/c1-12-8(11)6-5-7(10)9(6)13(2,3)4/h6H,5H2,1-4H3/t6-/m0/s1
InChI key:InChIKey=VEODGUWFLXRQPK-LURJTMIESA-N
SMILES:[Si](C)(C)(C)N1[C@H](C(OC)=O)CC1=O
Synonyms:
  • 2-Azetidinecarboxylic acid, 4-oxo-1-(trimethylsilyl)-, methyl ester, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.