CAS 1001907-59-0: B-(1-Methyl-1H-indazol-7-yl)boronic acid
Description:B-(1-Methyl-1H-indazol-7-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a 1-methyl-1H-indazole moiety. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and possessing moderate stability under standard laboratory conditions. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. It can participate in Suzuki-Miyaura cross-coupling reactions, which are valuable for constructing carbon-carbon bonds. Additionally, the indazole structure contributes to its potential biological activity, as indazole derivatives have been explored for their pharmacological properties. The compound's reactivity and functional versatility make it a significant building block in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H9BN2O2
InChI:InChI=1S/C8H9BN2O2/c1-11-8-6(5-10-11)3-2-4-7(8)9(12)13/h2-5,12-13H,1H3
InChI key:InChIKey=TWHUPAUNRIZSBL-UHFFFAOYSA-N
SMILES:OB(O)C1=CC=CC=2C=NN(C21)C
- Synonyms:
- Boronic acid, B-(1-methyl-1H-indazol-7-yl)-
- B-(1-Methyl-1H-indazol-7-yl)boronic acid
- (1-Methyl-1H-indazol-7-yl)boronic acid
- 1-Methylindazol-7-ylboronic acid
- (1-Methyl-1H-indazol-7-yl)boronicacid

Boronic acid, B-(1-methyl-1H-indazol-7-yl)-
Ref: IN-DA00016J
1g | 152.00 € | ||
5g | 596.00 € | ||
10g | To inquire | ||
100mg | 80.00 € | ||
250mg | 114.00 € |

1-Methyl-1H-indazole-7-boronic acid
Ref: 54-OR30588
1g | 165.00 € | ||
250mg | 67.00 € |

(1-Methyl-1H-indazol-7-yl)boronic acid
Ref: 10-F237004
1g | 146.00 € | ||
5g | 460.00 € | ||
250mg | 45.00 € |

1-Methylindazole-7-boronic acid
Ref: 3D-FM54479
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |