CAS 1001907-68-1
:B-(4,6-Dimethyl-3-pyridinyl)boronic acid
Description:
B-(4,6-Dimethyl-3-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that has two methyl substituents at the 4 and 6 positions. This compound typically exhibits properties such as being a white to off-white solid, with solubility in polar solvents like water and alcohols, which is common for boronic acids due to their ability to form hydrogen bonds. The presence of the pyridine ring contributes to its aromatic character and potential for coordination with metal ions. B-(4,6-Dimethyl-3-pyridinyl)boronic acid is often utilized in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, which are important for forming carbon-carbon bonds in the synthesis of pharmaceuticals and agrochemicals. Additionally, its boronic acid functionality allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including sensor technology and drug delivery systems.
Formula:C7H10BNO2
InChI:InChI=1S/C7H10BNO2/c1-5-3-6(2)9-4-7(5)8(10)11/h3-4,10-11H,1-2H3
InChI key:InChIKey=RKHAMMYSSVBPFN-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C(C)=CC(C)=NC1
Synonyms:- Boronic acid, B-(4,6-dimethyl-3-pyridinyl)-
- B-(4,6-Dimethyl-3-pyridinyl)boronic acid
- (4,6-Dimethylpyridin-3-yl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
