CAS 1002032-49-6
:4-Chloro-1-ethyl-N-methyl-1H-pyrazole-3-methanamine
Description:
4-Chloro-1-ethyl-N-methyl-1H-pyrazole-3-methanamine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a chloro substituent at the 4-position and an ethyl group at the 1-position contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The N-methyl group enhances its lipophilicity, potentially influencing its biological activity and solubility. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding due to the amine functional group, which may affect its pharmacokinetic properties. Additionally, the presence of halogen atoms often influences the compound's stability and reactivity. As with many pyrazole derivatives, it may possess interesting pharmacological properties, warranting further investigation for potential therapeutic uses. Safety and handling precautions should be observed, as with all chemical substances, due to the potential for toxicity or environmental impact.
Formula:C7H12ClN3
InChI:InChI=1S/C7H12ClN3/c1-3-11-5-6(8)7(10-11)4-9-2/h5,9H,3-4H2,1-2H3
InChI key:InChIKey=DWXWMXBEPOKAAY-UHFFFAOYSA-N
SMILES:C(NC)C=1C(Cl)=CN(CC)N1
Synonyms:- 1H-Pyrazole-3-methanamine, 4-chloro-1-ethyl-N-methyl-
- 4-Chloro-1-ethyl-N-methyl-1H-pyrazole-3-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.