CAS 1002032-61-2

5-Methyl-3-nitro-1H-pyrazole-1-propanoic acid

Description:

5-Methyl-3-nitro-1H-pyrazole-1-propanoic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a methyl group at the 5-position and a nitro group at the 3-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid functional group. It may exhibit acidic behavior, allowing it to participate in various chemical reactions, including esterification and amidation. The nitro group can also serve as a site for further chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, compounds of this class may have applications in pharmaceuticals, agrochemicals, or as research tools in biochemistry. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive to heat and shock.

Formula: C₇H₉N₃O₄

InChI: InChI=1S/C7H9N3O4/c1-5-4-6(10(13)14)8-9(5)3-2-7(11)12/h4H,2-3H2,1H3,(H,11,12)

InChI key: InChIKey=OYDQGYOBQLXBGH-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1N=C(N(=O)=O)C=C1C

Synonyms:

• 5-Methyl-3-nitro-1H-pyrazole-1-propanoic acid
• 1H-Pyrazole-1-propanoic acid, 5-methyl-3-nitro-