CAS 1002033-29-5
:1-[(2-Chloro-4-fluorophenyl)methyl]-1H-pyrazol-4-amine
Description:
1-[(2-Chloro-4-fluorophenyl)methyl]-1H-pyrazol-4-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a chloro and a fluoro substituent on a phenyl group, contributing to its unique reactivity and potential biological activity. The presence of the amine functional group enhances its ability to participate in hydrogen bonding, which can influence its solubility and interaction with biological targets. The molecular structure suggests that it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Additionally, the compound's potential applications could include roles as a pharmaceutical agent or in agrochemical formulations, although detailed studies would be necessary to elucidate its full profile and efficacy.
Formula:C10H9ClFN3
InChI:InChI=1S/C10H9ClFN3/c11-10-3-8(12)2-1-7(10)5-15-6-9(13)4-14-15/h1-4,6H,5,13H2
InChI key:InChIKey=QZIABYNUWYCBQP-UHFFFAOYSA-N
SMILES:C(C1=C(Cl)C=C(F)C=C1)N2C=C(N)C=N2
Synonyms:- 1H-Pyrazol-4-amine, 1-[(2-chloro-4-fluorophenyl)methyl]-
- 1-[(2-Chloro-4-fluorophenyl)methyl]-1H-pyrazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.