
CAS 1002033-31-9
:1-[(3-Methylphenyl)methyl]-1H-pyrazol-4-amine
Description:
1-[(3-Methylphenyl)methyl]-1H-pyrazol-4-amine, identified by its CAS number 1002033-31-9, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a 3-methylphenyl group attached to a methyl group, contributing to its aromatic properties and potentially influencing its reactivity and solubility. The presence of an amine functional group indicates that it can participate in hydrogen bonding, which may enhance its interactions with biological targets or other chemical species. The structural configuration suggests that it may exhibit specific pharmacological activities, making it of interest in medicinal chemistry. Its molecular properties, such as melting point, boiling point, and solubility, would depend on the specific arrangement of atoms and the presence of functional groups. Overall, this compound's unique structure positions it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C11H13N3
InChI:InChI=1S/C11H13N3/c1-9-3-2-4-10(5-9)7-14-8-11(12)6-13-14/h2-6,8H,7,12H2,1H3
InChI key:InChIKey=BYOCKGQNZDLGLZ-UHFFFAOYSA-N
SMILES:C(N1N=CC(N)=C1)C2=CC(C)=CC=C2
Synonyms:- 1-[(3-Methylphenyl)methyl]pyrazol-4-amine
- 1-[(3-Methylphenyl)methyl]-1H-pyrazol-4-amine
- 1-(3-Methylbenzyl)-1H-pyrazol-4-amine
- 1H-Pyrazol-4-amine, 1-[(3-methylphenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.