CAS 1002033-41-1

1-[(3-Chlorophenyl)methyl]-1H-pyrazol-4-amine

Description:

1-[(3-Chlorophenyl)methyl]-1H-pyrazol-4-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 3-chlorophenyl group attached to the pyrazole structure contributes to its unique properties, including potential biological activity. This compound typically exhibits moderate to high lipophilicity due to the aromatic chlorophenyl moiety, which can influence its solubility and permeability in biological systems. The amine functional group at the 4-position of the pyrazole ring may participate in hydrogen bonding, enhancing its reactivity and interaction with various biological targets. Additionally, the chlorine substituent can affect the electronic properties of the molecule, potentially impacting its pharmacological profile. Overall, this compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the context of targeting specific biological pathways or diseases. However, detailed studies are necessary to fully understand its biological activity and safety profile.

Formula: C₁₀H₁₀ClN₃

InChI: InChI=1S/C10H10ClN3/c11-9-3-1-2-8(4-9)6-14-7-10(12)5-13-14/h1-5,7H,6,12H2

InChI key: InChIKey=WHFMWXVGLGPVDW-UHFFFAOYSA-N

SMILES: C(N1N=CC(N)=C1)C2=CC(Cl)=CC=C2

Synonyms:

• 1-[(3-Chlorophenyl)methyl]-1H-pyrazol-4-amine
• 1-[(3-Chlorophenyl)methyl]pyrazol-4-amine
• 1H-Pyrazol-4-amine, 1-[(3-chlorophenyl)methyl]-
• 1-(3-Chlorobenzyl)-1H-pyrazol-4-amine