CAS 1002033-43-3

1-[(2,6-Dichlorophenyl)methyl]-1H-pyrazol-3-amine

Description:

1-[(2,6-Dichlorophenyl)methyl]-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 2,6-dichlorophenyl group attached to the pyrazole structure contributes to its unique properties, including potential biological activity. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding due to the amine functional group, influencing its solubility and reactivity. The dichlorophenyl moiety may enhance lipophilicity, potentially affecting its bioavailability and interaction with biological targets. Additionally, the compound's stability, melting point, and solubility in different solvents would depend on its specific molecular interactions. As with many pyrazole derivatives, it may be investigated for applications in drug development, particularly in areas such as anti-inflammatory or anticancer therapies. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₀H₉Cl₂N₃

InChI: InChI=1S/C10H9Cl2N3/c11-8-2-1-3-9(12)7(8)6-15-5-4-10(13)14-15/h1-5H,6H2,(H2,13,14)

InChI key: InChIKey=CUAVHUBZJSMRCV-UHFFFAOYSA-N

SMILES: C(C1=C(Cl)C=CC=C1Cl)N2N=C(N)C=C2

Synonyms:

• 1H-Pyrazol-3-amine, 1-[(2,6-dichlorophenyl)methyl]-
• 1-[(2,6-Dichlorophenyl)methyl]-1H-pyrazol-3-amine

1-[(2,6-Dichlorophenyl)methyl]-1H-pyrazol-3-amine

CAS: 1002033-43-3

Versatile small molecule scaffold

Formula: C₁₀H₉Cl₂N₃

Purity: Min. 95%

Molecular weight: 242.1 g/mol

Ref: 3D-CQB03343