CymitQuimica logo

CAS 1002033-53-5

:

4-Nitro-1H-pyrazole-1-ethanamine

Description:
4-Nitro-1H-pyrazole-1-ethanamine is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a nitro group (-NO2) at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. The ethanamine group (-CH2-CH2-NH2) attached to the 1-position enhances its basicity and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, safety considerations should be taken into account, as nitro compounds can be hazardous and may require careful handling. Overall, 4-Nitro-1H-pyrazole-1-ethanamine is a versatile compound with potential applications in research and industry.
Formula:C5H8N4O2
InChI:InChI=1S/C5H8N4O2/c6-1-2-8-4-5(3-7-8)9(10)11/h3-4H,1-2,6H2
InChI key:InChIKey=GZTQKSKBFGFMNR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CN(CCN)N=C1
Synonyms:
  • 4-Nitro-1H-pyrazole-1-ethanamine
  • 1H-Pyrazole-1-ethanamine, 4-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.