CAS 1002033-58-0

Methyl 5-methyl-3-nitro-1H-pyrazole-1-propanoate

Description:

Methyl 5-methyl-3-nitro-1H-pyrazole-1-propanoate is a chemical compound characterized by its pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a methyl group and a nitro group, which contribute to its reactivity and potential applications in various chemical reactions. The presence of the propanoate moiety indicates that it is an ester, which typically enhances its solubility in organic solvents and may influence its biological activity. The nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity and stability. Methyl 5-methyl-3-nitro-1H-pyrazole-1-propanoate may be of interest in medicinal chemistry and agrochemicals due to its potential biological activities. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for practical applications. Overall, this compound exemplifies the diverse chemistry associated with pyrazole derivatives.

Formula: C₈H₁₁N₃O₄

InChI: InChI=1S/C8H11N3O4/c1-6-5-7(11(13)14)9-10(6)4-3-8(12)15-2/h5H,3-4H2,1-2H3

InChI key: InChIKey=MNNXGNJXAQAKTL-UHFFFAOYSA-N

SMILES: C(CC(OC)=O)N1N=C(N(=O)=O)C=C1C

Synonyms:

• 1H-Pyrazole-1-propanoic acid, 5-methyl-3-nitro-, methyl ester
• Methyl 5-methyl-3-nitro-1H-pyrazole-1-propanoate