
CAS 100208-32-0
:1,5-Bis[2,2-dimethyl-1-(1-methylethyl)-3-(2-methyl-1-oxopropoxy)propyl] pentanedioate
Description:
1,5-Bis[2,2-dimethyl-1-(1-methylethyl)-3-(2-methyl-1-oxopropoxy)propyl] pentanedioate, with CAS number 100208-32-0, is a complex organic compound characterized by its multi-functional ester structure. This substance features a pentanedioate backbone, which contributes to its potential as a plasticizer or additive in various applications. The presence of multiple alkyl groups, including dimethyl and isopropyl moieties, enhances its hydrophobic properties, making it suitable for use in non-polar environments. Additionally, the compound contains ester functional groups, which can influence its reactivity and solubility in organic solvents. Its molecular structure suggests potential applications in the fields of polymer chemistry and materials science, particularly in the formulation of coatings, adhesives, and other polymer-based products. Safety and handling considerations are essential, as with any chemical substance, and proper precautions should be taken to mitigate any risks associated with its use. Overall, this compound exemplifies the complexity and versatility of modern synthetic organic chemistry.
Formula:C29H52O8
InChI:InChI=1S/C29H52O8/c1-18(2)24(28(9,10)16-34-26(32)20(5)6)36-22(30)14-13-15-23(31)37-25(19(3)4)29(11,12)17-35-27(33)21(7)8/h18-21,24-25H,13-17H2,1-12H3
InChI key:InChIKey=RNKJNASTTQKQFT-UHFFFAOYSA-N
SMILES:C(C(COC(C(C)C)=O)(C)C)(OC(CCCC(OC(C(COC(C(C)C)=O)(C)C)C(C)C)=O)=O)C(C)C
Synonyms:- Pentanedioic acid, bis[2,2-dimethyl-1-(1-methylethyl)-3-(2-methyl-1-oxopropoxy)propyl] ester
- Bis[2,2-dimethyl-1-(1-methylethyl)-3-(2-methyl-1-oxopropoxy)propyl] glutarate
- Pentanedioic acid, 1,5-bis[2,2-dimethyl-1-(1-methylethyl)-3-(2-methyl-1-oxopropoxy)propyl] ester
- 1,5-Bis[2,2-dimethyl-1-(1-methylethyl)-3-(2-methyl-1-oxopropoxy)propyl] pentanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pentanedioic acid, 1,5-bis[2,2-dimethyl-1-(1-methylethyl)-3-(2-methyl-1-oxopropoxy)propyl] ester
CAS:Formula:C29H52O8Molecular weight:528.7184
