CAS 100208-41-1

1-[(1-Methylethoxy)methoxy]methanol

Description:

1-[(1-Methylethoxy)methoxy]methanol, with the CAS number 100208-41-1, is an organic compound characterized by its ether and alcohol functional groups. It features a methanol backbone with an ether substituent that includes a branched alkyl group, specifically a 1-methylethoxy group. This structure contributes to its properties, such as moderate polarity and potential solubility in both polar and non-polar solvents. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and etherification. Additionally, its molecular structure may influence its boiling point, viscosity, and reactivity, making it relevant in applications such as solvents, intermediates in organic synthesis, or in formulations requiring specific solubility characteristics. Safety data should be consulted for handling and storage, as compounds with similar structures can exhibit varying degrees of toxicity and environmental impact. Overall, 1-[(1-Methylethoxy)methoxy]methanol is a versatile compound with potential utility in chemical processes and formulations.

Formula: C₅H₁₂O₃

InChI: InChI=1S/C5H12O3/c1-5(2)8-4-7-3-6/h5-6H,3-4H2,1-2H3

InChI key: InChIKey=LHCRFMIUQHIZLC-UHFFFAOYSA-N

SMILES: O(COCO)C(C)C

Synonyms:

• Methanol, 1-[(1-methylethoxy)methoxy]-
• (Isopropoxymethoxy)methanol
• Methanol, [(1-methylethoxy)methoxy]-
• 1-[(1-Methylethoxy)methoxy]methanol

Methanol, 1-[(1-methylethoxy)methoxy]-

CAS: 100208-41-1

Formula: C₅H₁₂O₃

Molecular weight: 120.147

Ref: IN-DA00019J