CAS 100208-42-2

1-[[(1-Methylethoxy)methoxy]methoxy]methanol

Description:

1-[[(1-Methylethoxy)methoxy]methoxy]methanol, with the CAS number 100208-42-2, is an organic compound characterized by its complex ether structure. It features multiple methoxy groups, which are indicative of its potential as a solvent or reagent in various chemical reactions. The presence of the 1-methylethoxy group suggests that it may exhibit unique solubility properties, making it useful in formulations requiring specific solvent characteristics. This compound is likely to be a colorless liquid at room temperature, with a relatively low viscosity due to its ether functionalities. Its molecular structure implies that it may participate in hydrogen bonding, influencing its boiling point and miscibility with other solvents. Additionally, the presence of multiple ether linkages may contribute to its stability and reactivity under certain conditions. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards in laboratory or industrial settings.

Formula: C₆H₁₄O₄

InChI: InChI=1S/C6H14O4/c1-6(2)10-5-9-4-8-3-7/h6-7H,3-5H2,1-2H3

InChI key: InChIKey=CKTKXGAZWKOZAP-UHFFFAOYSA-N

SMILES: C(OCOCO)OC(C)C

Synonyms:

• 1-[[(1-Methylethoxy)methoxy]methoxy]methanol
• Methanol, 1-[[(1-methylethoxy)methoxy]methoxy]-
• Methanol, [[(1-methylethoxy)methoxy]methoxy]-

Methanol, 1-[[(1-methylethoxy)methoxy]methoxy]-

CAS: 100208-42-2

Formula: C₆H₁₄O₄

Molecular weight: 150.173

Ref: IN-DA00019I