CymitQuimica logo

CAS 10021-67-7

:

2-AMINO-1-THIOPHEN-2-YL-ETHANOL

Description:
2-Amino-1-thiophen-2-yl-ethanol, with the CAS number 10021-67-7, is an organic compound characterized by the presence of both an amino group and a thiophene ring. This compound features a hydroxyl group (-OH) attached to an ethyl chain, which contributes to its classification as an alcohol. The thiophene ring, a five-membered aromatic heterocycle containing sulfur, imparts unique electronic properties and potential reactivity to the molecule. The amino group enhances its basicity and can participate in hydrogen bonding, influencing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of both the thiophene and amino functionalities may allow for diverse chemical modifications, expanding its utility in various chemical syntheses. Overall, 2-amino-1-thiophen-2-yl-ethanol is a versatile compound with significant implications in both organic synthesis and biological applications.
Formula:C6H9NOS
InChI:InChI=1/C6H9NOS/c7-4-5(8)6-2-1-3-9-6/h1-3,5,8H,4,7H2
SMILES:c1cc(C(CN)O)sc1
Synonyms:
  • Akos Bc-1274
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.