
CAS 1002129-70-5
:1,4-Dihydro-5-nitro-2H-3,1-benzoxazin-2-one
Description:
1,4-Dihydro-5-nitro-2H-3,1-benzoxazin-2-one is a chemical compound characterized by its unique bicyclic structure, which includes a benzoxazine ring system. This compound features a nitro group at the 5-position and a dihydro configuration at the 1,4-positions, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitro group enhances its electrophilic properties, making it a candidate for further chemical modifications. Additionally, the benzoxazine moiety is known for its thermal stability and ability to form polymers, which can be advantageous in material science. The compound is typically synthesized through specific organic reactions that involve the formation of the benzoxazine structure. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important considerations for its practical applications. Overall, 1,4-Dihydro-5-nitro-2H-3,1-benzoxazin-2-one is a versatile compound with significant potential in various chemical research and industrial applications.
Formula:C8H6N2O4
InChI:InChI=1S/C8H6N2O4/c11-8-9-6-2-1-3-7(10(12)13)5(6)4-14-8/h1-3H,4H2,(H,9,11)
InChI key:InChIKey=CURYBKKHSYYDRP-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(NC(=O)OC2)=CC=C1
Synonyms:- 1,4-Dihydro-5-nitro-2H-3,1-benzoxazin-2-one
- 5-Nitro-1,4-dihydrobenzo[d][1,3]oxazin-2-one
- 2H-3,1-Benzoxazin-2-one, 1,4-dihydro-5-nitro-
- 5-Nitro-1H-benzo[d][1,3]oxazin-2(4H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.