CymitQuimica logo

CAS 100214-79-7

:

CL 205086

Description:
CL 205086, also known by its CAS number 100214-79-7, is a chemical compound that has garnered attention in various fields, particularly in medicinal chemistry and pharmacology. It is characterized as a synthetic compound with a specific molecular structure that contributes to its biological activity. The substance is often studied for its potential therapeutic applications, particularly in the context of its interaction with biological targets. Its properties may include solubility in organic solvents, stability under certain conditions, and specific reactivity patterns that make it suitable for various chemical reactions. Additionally, CL 205086 may exhibit unique pharmacokinetic and pharmacodynamic profiles, influencing its efficacy and safety in biological systems. As with many chemical substances, understanding its characteristics is crucial for assessing its potential uses and implications in research and industry. However, detailed information regarding its specific applications, mechanisms of action, and safety profile would require further investigation and access to specialized literature.
Formula:Unspecified
InChI:InChI=1/C3H3N3O2/c7-6(8)3-1-4-2-5-3/h1-2H,(H,4,5)
SMILES:c1c([nH]cn1)N(=O)=O
Synonyms:
  • Cl 205086
  • 5-nitro-1H-imidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.