CAS 1002243-76-6

1-[(4-Bromo-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

Description:

1-[(4-Bromo-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes multiple functional groups such as a pyrazole ring, a carboxylic acid, and a hydrazide moiety. The presence of the bromine atom enhances its reactivity and may influence its biological activity. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential pharmacological properties. It may exhibit various biological activities, including antimicrobial or anti-inflammatory effects, depending on its specific interactions with biological targets. The hydrazide functional group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's solubility and stability can vary based on the solvent and environmental conditions, which are important considerations for its application in laboratory experiments. Overall, this compound represents a significant interest in the field of drug discovery and development.

Formula: C₈H₉BrN₆O

InChI: InChI=1S/C8H9BrN6O/c9-6-3-11-15(4-6)5-14-2-1-7(13-14)8(16)12-10/h1-4H,5,10H2,(H,12,16)

InChI key: InChIKey=XCMJUFLHSSKEEF-UHFFFAOYSA-N

SMILES: C(N1N=C(C(NN)=O)C=C1)N2N=CC(Br)=C2

Synonyms:

• 1-[(4-Bromo-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
• 1H-Pyrazole-3-carboxylic acid, 1-[(4-bromo-1H-pyrazol-1-yl)methyl]-, hydrazide