CAS 1002243-80-2
:6-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-2(1H)-pyrimidinethione
Description:
6-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-2(1H)-pyrimidinethione is a chemical compound characterized by its unique structural features, which include a pyrimidinethione core and a pyrazole substituent. The presence of the ethyl and methyl groups on the pyrazole ring contributes to its hydrophobic properties, potentially influencing its solubility and reactivity. This compound may exhibit biological activity due to the presence of the thione functional group, which can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 6-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-2(1H)-pyrimidinethione represents a class of compounds that may have significant implications in both synthetic and applied chemistry.
Formula:C10H12N4S
InChI:InChI=1S/C10H12N4S/c1-3-14-7(2)8(6-12-14)9-4-5-11-10(15)13-9/h4-6H,3H2,1-2H3,(H,11,13,15)
InChI key:InChIKey=GRVKVQMKUBMNRH-UHFFFAOYSA-N
SMILES:CC1=C(C=NN1CC)C=2NC(=S)N=CC2
Synonyms:- 6-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-2(1H)-pyrimidinethione
- 2(1H)-Pyrimidinethione, 6-(1-ethyl-5-methyl-1H-pyrazol-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.