CAS 1002243-83-5

Methyl 1-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylate

Description:

Methyl 1-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylate is a chemical compound characterized by its complex structure, which includes multiple pyrazole rings and a bromine substituent. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of bromine and methyl groups on the pyrazole rings can influence its biological activity and interaction with other molecules. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them potential candidates for drug development or agricultural applications. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's stability, solubility in organic solvents, and potential for forming hydrogen bonds are important characteristics that can affect its behavior in different environments. Overall, this compound's unique features make it a subject of interest in both synthetic chemistry and medicinal research.

Formula: C₁₁H₁₃BrN₄O₂

InChI: InChI=1S/C11H13BrN4O2/c1-7-10(12)8(2)16(13-7)6-15-5-4-9(14-15)11(17)18-3/h4-5H,6H2,1-3H3

InChI key: InChIKey=LRSPMSWDFPDPHE-UHFFFAOYSA-N

SMILES: C(N1C(C)=C(Br)C(C)=N1)N2N=C(C(OC)=O)C=C2

Synonyms:

• Methyl 1-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylate
• 1H-Pyrazole-3-carboxylic acid, 1-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-, methyl ester