CymitQuimica logo

CAS 100231-77-4

:

N-(2-Aminoethyl)-1,1,2-ethanetriamine

Description:
N-(2-Aminoethyl)-1,1,2-ethanetriamine, also known as AEEA, is an organic compound characterized by its amine functional groups, which contribute to its reactivity and solubility in water. It features a branched structure with three amine groups, making it a polyamine. This compound is typically colorless to pale yellow and has a strong, ammonia-like odor. AEEA is hygroscopic, meaning it can absorb moisture from the air, which can affect its handling and storage. It is primarily used in the synthesis of epoxy resins, as a curing agent, and in various chemical formulations due to its ability to enhance adhesion and improve mechanical properties. Additionally, AEEA can act as a chelating agent, binding metal ions in various applications. Safety considerations are important when handling this compound, as it can be irritating to the skin, eyes, and respiratory system. Proper protective equipment and ventilation are recommended during its use.
Formula:C4H14N4
InChI:InChI=1S/C4H14N4/c5-1-2-8-3-4(6)7/h4,8H,1-3,5-7H2
InChI key:InChIKey=CFAZGYXPBDCSPT-UHFFFAOYSA-N
SMILES:C(NCCN)C(N)N
Synonyms:
  • 1,1,2-Ethanetriamine, N2-(2-aminoethyl)-
  • N-(2-Aminoethyl)-1,1,2-ethanetriamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.