CAS 100237-71-6
:DIMETHYLAMINOARYLDYE
Description:
Dimethylaminoaryldye, identified by its CAS number 100237-71-6, is a synthetic organic compound commonly used in various applications, particularly in the dye and pigment industries. This substance typically features a structure that includes an aryl group, which is a cyclic compound containing carbon atoms, and dimethylamino groups that enhance its solubility and reactivity. The presence of the dimethylamino functional group often imparts basic properties, allowing the dye to interact with various substrates, making it useful in textile and paper dyeing processes. Dimethylaminoaryldyes are known for their vibrant colors and stability under various conditions, although their specific properties can vary based on the precise molecular structure. Additionally, safety considerations are important, as some dyes may pose health risks or environmental concerns, necessitating careful handling and disposal. Overall, dimethylaminoaryldyes represent a significant class of compounds in the field of colorants, with diverse applications across industries.
Formula:C34H33F3N2O3S
InChI:InChI=1/C33H33N2.CHF3O3S/c1-34(2)30-22-18-28(19-23-30)32(26-12-7-5-8-13-26)16-11-17-33(27-14-9-6-10-15-27)29-20-24-31(25-21-29)35(3)4;2-1(3,4)8(5,6)7/h5-25H,1-4H3;(H,5,6,7)/q+1;/p-1
Synonyms:- Methanaminium, N-(4-(5-(4-(dimethylamino)phenyl)-1,5-diphenyl-2,4-pentadienylidene)-2,5-cyclohexadien-1-ylidene)-N-methyl-, salt with trifluoromethanesulfonic acid (1:1)
- N-(4-{(2E,4Z)-5-[4-(dimethylamino)phenyl]-1,5-diphenylpenta-2,4-dien-1-ylidene}cyclohexa-2,5-dien-1-ylidene)-N-methylmethanaminium trifluoromethanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
[4-[5-(4-Dimethylaminophenyl)-1,5-diphenyl-penta-2,4-dienylidene]-1-cyclohexa-2,5-dienylidene]-dimethyl-azanium trifluoromethanesulfonate
CAS:Formula:C34H33F3N2O3SMolecular weight:606.6976
