
CAS 100238-55-9
:4-(2-Chloroethoxy)phenol
Description:
4-(2-Chloroethoxy)phenol, with the CAS number 100238-55-9, is an organic compound characterized by the presence of a phenolic group substituted with a chloroethoxy moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents and exhibits limited solubility in water due to the hydrophobic nature of the phenolic ring. The chloroethoxy group introduces both polar and non-polar characteristics, influencing its reactivity and interactions with other substances. 4-(2-Chloroethoxy)phenol may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it useful in synthetic organic chemistry. Additionally, it may exhibit biological activity, which could be relevant in pharmacological or agrochemical applications. Safety data should be consulted for handling and exposure risks, as compounds with chlorine substituents can pose health hazards. Overall, this compound's unique structure contributes to its potential utility in various chemical and industrial applications.
Formula:C8H9ClO2
InChI:InChI=1S/C8H9ClO2/c9-5-6-11-8-3-1-7(10)2-4-8/h1-4,10H,5-6H2
InChI key:InChIKey=YMIYHUNATGXCNV-UHFFFAOYSA-N
SMILES:O(CCCl)C1=CC=C(O)C=C1
Synonyms:- Phenol, 4-(2-chloroethoxy)-
- 4-(2-Chloroethoxy)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
