CAS 10024-74-5
:Bis(1-phenylethyl)amine
Description:
Bis(1-phenylethyl)amine, with the CAS number 10024-74-5, is an organic compound characterized by its amine functional group and two 1-phenylethyl substituents. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively low volatility. It exhibits moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic phenyl groups. Bis(1-phenylethyl)amine can participate in various chemical reactions typical of amines, such as nucleophilic substitutions and acylation. Its structure allows for potential applications in organic synthesis and as a ligand in coordination chemistry. Additionally, the presence of the phenyl groups may impart unique electronic properties, making it of interest in materials science and pharmaceuticals. Safety data indicates that, like many amines, it should be handled with care due to potential irritant effects on skin and mucous membranes. Proper storage in a cool, dry place away from incompatible substances is recommended to maintain its stability and integrity.
Formula:C16H19N
InChI:InChI=1/C16H19N/c1-13(15-9-5-3-6-10-15)17-14(2)16-11-7-4-8-12-16/h3-14,17H,1-2H3
InChI key:InChIKey=NXLACVVNHYIYJN-UHFFFAOYSA-N
SMILES:C(NC(C)C1=CC=CC=C1)(C)C2=CC=CC=C2
Synonyms:- 1-phenyl-N-(1-phenylethyl)ethanamine
- Amine, diethyl, 1,1'-diphenyl
- Benzenemethanamine, alpha-methyl-N-(1-phenylethyl)-
- Benzenemethanamine, alpha-methyl-N-(1-phenylethyl)- (9CI)
- Benzenemethanamine, α-methyl-N-(1-phenylethyl)-
- Bis(1-phenylethyl)amine
- Bis(alpha-methylbenzyl)amine
- Bis(α-methylbenzyl)amine
- Bis(α-phenylethyl)amine
- Di(α-phenylethyl)amine
- Dibenzylamine, alpha,alpha'-dimethyl-
- Dibenzylamine, α,α′-dimethyl-
- Hsdb 2776
- N-(1-Phenylethyl)-α-methylbenzylamine
- Nsc 13511
- α-Methyl-N-(1-phenylethyl)benzenemethanamine
- bis(1-phenylethyl)amineQ: What is
- N-(α-Methylbenzyl)-α-methylbenzenemethanamine
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
