CymitQuimica logo

CAS 100241-89-2

:

5-Isothiazolecarboxylicacid,2,3-dihydro-3-oxo-,methylester(9CI)

Description:
5-Isothiazolecarboxylic acid, 2,3-dihydro-3-oxo-, methyl ester, commonly referred to by its CAS number 100241-89-2, is an organic compound characterized by its isothiazole ring structure, which contributes to its unique chemical properties. This compound features a carboxylic acid functional group and a methyl ester, indicating it can participate in various chemical reactions, including esterification and hydrolysis. The presence of the isothiazole moiety suggests potential biological activity, making it of interest in pharmaceutical and agrochemical research. Typically, compounds like this may exhibit moderate to high solubility in polar solvents due to the presence of polar functional groups. Additionally, the compound may display specific reactivity patterns, such as nucleophilic attack at the carbonyl carbon or electrophilic substitution on the isothiazole ring. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are crucial for applications in synthesis and formulation. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C5H5NO3S
InChI:InChI=1/C5H5NO3S/c1-9-5(8)3-2-4(7)6-10-3/h2H,1H3,(H,6,7)
SMILES:COC(=O)c1cc(ns1)O
Synonyms:
  • Methyl 3-Oxo-2,3-Dihydro-1,2-Thiazole-5-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.