CymitQuimica logo

CAS 100258-40-0

:

27-Methyl-2,5,8,11,14,17,20,23,26-nonaoxaoctacosane

Description:
27-Methyl-2,5,8,11,14,17,20,23,26-nonaoxaoctacosane, with the CAS number 100258-40-0, is a synthetic chemical compound characterized by its long carbon chain and multiple ether linkages. This compound belongs to the class of polyether compounds, which are known for their unique properties, including low volatility and high thermal stability. The presence of multiple ether groups contributes to its solubility in various organic solvents while making it less soluble in water. The methyl group at the 27th position introduces branching, which can influence its physical properties, such as melting and boiling points. Typically, compounds like this are studied for their potential applications in materials science, particularly in the development of surfactants, lubricants, or as additives in various formulations. Additionally, due to its structural complexity, it may exhibit interesting interactions with other chemical species, making it a subject of interest in both industrial and academic research.
Formula:C20H42O9
InChI:InChI=1S/C20H42O9/c1-20(2)29-19-18-28-17-16-27-15-14-26-13-12-25-11-10-24-9-8-23-7-6-22-5-4-21-3/h20H,4-19H2,1-3H3
InChI key:InChIKey=CDKPNBHJUVRFOT-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCOCCOCCOC)OCCOCCOC(C)C
Synonyms:
  • 27-Methyl-2,5,8,11,14,17,20,23,26-nonaoxaoctacosane
  • 2,5,8,11,14,17,20,23,26-Nonaoxaoctacosane, 27-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.