CAS 100258-41-1

30-Methyl-2,5,8,11,14,17,20,23,26,29-decaoxahentriacontane

Description:

30-Methyl-2,5,8,11,14,17,20,23,26,29-decaoxahentriacontane, with CAS number 100258-41-1, is a synthetic organic compound characterized by its long carbon chain and multiple ether linkages. This compound belongs to the class of polyether compounds, which are known for their unique properties, including flexibility, low toxicity, and resistance to degradation. The presence of a methyl group at the 30th carbon position contributes to its structural complexity and may influence its physical properties, such as melting and boiling points. Typically, compounds of this nature exhibit low volatility and high thermal stability, making them suitable for various applications, including as lubricants or in polymer formulations. Additionally, the extensive ether functionality can enhance solubility in polar solvents and may impart unique interactions with biological systems. Overall, 30-Methyl-2,5,8,11,14,17,20,23,26,29-decaoxahentriacontane represents a fascinating example of synthetic chemistry with potential utility in industrial and research settings.

Formula: C₂₂H₄₆O₁₀

InChI: InChI=1S/C22H46O10/c1-22(2)32-21-20-31-19-18-30-17-16-29-15-14-28-13-12-27-11-10-26-9-8-25-7-6-24-5-4-23-3/h22H,4-21H2,1-3H3

InChI key: InChIKey=LNFDGGCKYXVWNP-UHFFFAOYSA-N

SMILES: O(CCOCCOCCOCCOCCOCCOC)CCOCCOCCOC(C)C

Synonyms:

• 30-Methyl-2,5,8,11,14,17,20,23,26,29-decaoxahentriacontane
• 2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontane, 30-methyl-

2,5,8,11,14,17,20,23,26,29-Decaoxahentriacontane, 30-methyl-

CAS: 100258-41-1

Formula: C₂₂H₄₆O₁₀

Molecular weight: 470.59463999999974

Ref: IN-DA0001EP