
CAS 100258-43-3
:21-Methyl-2,5,8,11,14,17,20-heptaoxadocosane
Description:
21-Methyl-2,5,8,11,14,17,20-heptaoxadocosane, with the CAS number 100258-43-3, is a synthetic organic compound characterized by its long carbon chain and multiple ether functional groups. This molecule features a total of 21 carbon atoms, with seven ether linkages (–O–) integrated into its structure, which contributes to its unique physical and chemical properties. The presence of these ether groups typically imparts increased solubility in polar solvents compared to hydrocarbons of similar length. The methyl group at the 21st position suggests that it may exhibit branched-chain characteristics, potentially influencing its melting and boiling points, as well as its reactivity. Such compounds are often studied for their applications in materials science, particularly in the development of surfactants, lubricants, or as intermediates in organic synthesis. Additionally, the structural complexity may allow for interesting interactions in biological systems, although specific biological activity would require further investigation. Overall, this compound exemplifies the diverse nature of synthetic organic chemistry and its potential applications.
Formula:C16H34O7
InChI:InChI=1S/C16H34O7/c1-16(2)23-15-14-22-13-12-21-11-10-20-9-8-19-7-6-18-5-4-17-3/h16H,4-15H2,1-3H3
InChI key:InChIKey=LYWMONBTYKZDMG-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOC)CCOCCOC(C)C
Synonyms:- 2,5,8,11,14,17,20-Heptaoxadocosane, 21-methyl-
- 21-Methyl-2,5,8,11,14,17,20-heptaoxadocosane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
