
CAS 100258-45-5
:Octadecanoic acid, 12-[(1-oxooctadecyl)oxy]-, 2-hexyldecyl ester
Description:
Octadecanoic acid, 12-[(1-oxooctadecyl)oxy]-, 2-hexyldecyl ester, commonly referred to as a type of fatty acid ester, is characterized by its long hydrocarbon chains, which contribute to its hydrophobic properties. This compound features a fatty acid backbone derived from octadecanoic acid (also known as stearic acid) and is modified with a hexyldecyl group, enhancing its lipophilicity. The presence of the ester functional group indicates that it is formed through the reaction of an alcohol (in this case, a hexyldecyl alcohol) with the acid. Such esters typically exhibit low solubility in water but are soluble in organic solvents, making them useful in various applications, including cosmetics, lubricants, and as surfactants. The molecular structure suggests potential applications in formulations requiring emulsification or stabilization due to its amphiphilic nature. Additionally, the compound may exhibit properties such as thermal stability and resistance to oxidation, which are advantageous in industrial applications. Overall, its unique structure and properties make it a valuable compound in both chemical and industrial contexts.
Formula:C52H102O4
InChI:InChI=1S/C52H102O4/c1-5-9-13-17-19-20-21-22-23-24-25-26-31-35-41-47-52(54)56-50(44-38-16-12-8-4)45-39-33-29-27-28-30-34-40-46-51(53)55-48-49(42-36-15-11-7-3)43-37-32-18-14-10-6-2/h49-50H,5-48H2,1-4H3
InChI key:InChIKey=YGERJSGCMKZWEK-UHFFFAOYSA-N
SMILES:C(OC(CCCCCCCCCCCCCCCCC)=O)(CCCCCCCCCCC(OCC(CCCCCCCC)CCCCCC)=O)CCCCCC
Synonyms:- 2-Hexyldecyl 12-[(1-oxooctadecyl)oxy]octadecanoate
- Octadecanoic acid, 12-[(1-oxooctadecyl)oxy]-, 2-hexyldecyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Octadecanoic acid, 12-[(1-oxooctadecyl)oxy]-, 2-hexyldecyl ester
CAS:Formula:C52H102O4Molecular weight:791.3639
