CAS 1002651-67-3

1-Ethyl-N-methyl-1H-pyrazole-5-methanamine

Description:

1-Ethyl-N-methyl-1H-pyrazole-5-methanamine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethyl group and a methyl group attached to the nitrogen atoms, contributing to its unique properties. It is typically a colorless to light yellow liquid or solid, depending on its purity and form. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, influencing its solubility in polar solvents. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its CAS number, 1002651-67-3, allows for easy identification in chemical databases. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 1-Ethyl-N-methyl-1H-pyrazole-5-methanamine represents a versatile structure with potential applications in chemical synthesis and research.

Formula: C₇H₁₃N₃

InChI: InChI=1S/C7H13N3/c1-3-10-7(6-8-2)4-5-9-10/h4-5,8H,3,6H2,1-2H3

InChI key: InChIKey=IPBXAQNEXLMXRW-UHFFFAOYSA-N

SMILES: C(NC)C=1N(CC)N=CC1

Synonyms:

• [(1-Ethyl-1H-pyrazol-5-yl)methyl](methyl)amine
• 1-(2-Ethylpyrazol-3-yl)-N-methylmethanamine
• 1-Ethyl-N-methyl-1H-pyrazole-5-methanamine
• 1H-Pyrazole-5-methanamine, 1-ethyl-N-methyl-
• 1-(1-Ethyl-1H-pyrazol-5-yl)-N-methylmethanamine