CAS 1002651-68-4
:1-Ethyl-N-methyl-1H-pyrazole-4-methanamine
Description:
1-Ethyl-N-methyl-1H-pyrazole-4-methanamine is a chemical compound characterized by its unique pyrazole structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features an ethyl group and a methyl group attached to the nitrogen atoms, contributing to its overall molecular complexity. It is typically classified as an organic amine due to the presence of the amine functional group (-NH2). The compound may exhibit properties such as moderate solubility in polar solvents, and its reactivity can be influenced by the presence of the pyrazole ring, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the presence of the ethyl and methyl groups can affect its steric and electronic properties, potentially influencing its biological activity and interactions in various applications, including pharmaceuticals and agrochemicals. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C7H13N3
InChI:InChI=1S/C7H13N3/c1-3-10-6-7(4-8-2)5-9-10/h5-6,8H,3-4H2,1-2H3
InChI key:InChIKey=LNLBAJDAQVQFBD-UHFFFAOYSA-N
SMILES:C(NC)C1=CN(CC)N=C1
Synonyms:- [(1-Ethyl-1H-pyrazol-4-yl)methyl](methyl)amine
- 1-(1-Ethylpyrazol-4-yl)-N-methylmethanamine
- 1-Ethyl-N-methyl-1H-pyrazole-4-methanamine
- 1H-Pyrazole-4-methanamine, 1-ethyl-N-methyl-
- 1-Ethyl-N-methyl-4-pyrazolemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
