CAS 1002651-89-9

3-[[(1-Methyl-1H-pyrazol-3-yl)carbonyl]amino]benzoic acid

Description:

3-[[(1-Methyl-1H-pyrazol-3-yl)carbonyl]amino]benzoic acid, identified by its CAS number 1002651-89-9, is a chemical compound characterized by its complex structure that includes a benzoic acid moiety and a pyrazole ring. This compound features a carboxylic acid functional group, which contributes to its acidic properties, and an amide linkage that connects the pyrazole derivative to the benzoic acid. The presence of the methyl group on the pyrazole ring enhances its lipophilicity, potentially influencing its biological activity and solubility. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural characteristics suggest potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, reactivity, and solubility in different solvents are important factors that would influence its practical use in research and industry. Overall, this compound represents a unique combination of functional groups that may offer diverse applications in chemical and pharmaceutical research.

Formula: C₁₂H₁₁N₃O₃

InChI: InChI=1S/C12H11N3O3/c1-15-6-5-10(14-15)11(16)13-9-4-2-3-8(7-9)12(17)18/h2-7H,1H3,(H,13,16)(H,17,18)

InChI key: InChIKey=CGFLTCVMZJDNKM-UHFFFAOYSA-N

SMILES: C(NC1=CC(C(O)=O)=CC=C1)(=O)C2=NN(C)C=C2

Synonyms:

• 3-[[(1-Methyl-1H-pyrazol-3-yl)carbonyl]amino]benzoic acid
• Benzoic acid, 3-[[(1-methyl-1H-pyrazol-3-yl)carbonyl]amino]-

3-(1-Methyl-1H-pyrazole-3-amido)benzoic acid

CAS: 1002651-89-9

Versatile small molecule scaffold

Formula: C₁₂H₁₁N₃O₃

Purity: Min. 95%

Molecular weight: 245.23 g/mol

Ref: 3D-CQB65189