CAS 10027-33-5: 1,3-Benzenedicarboxylic acid, sodium salt (1:2)

Description:1,3-Benzenedicarboxylic acid, sodium salt (1:2), commonly known as sodium phthalate, is a sodium salt derived from phthalic acid. It appears as a white to off-white crystalline powder and is soluble in water, making it useful in various applications. This compound is characterized by its ability to act as a buffering agent and is often utilized in the formulation of pharmaceuticals, cosmetics, and food products. It exhibits properties typical of carboxylate salts, including the ability to form complexes with metal ions. The presence of two carboxylate groups contributes to its acidity and reactivity, allowing it to participate in various chemical reactions. Additionally, it is considered to have low toxicity, which makes it suitable for use in consumer products. Its stability under normal conditions and compatibility with other substances further enhance its utility in industrial and laboratory settings. Overall, sodium phthalate serves as an important compound in both chemical synthesis and practical applications across multiple fields.

Formula:C₈H₆O₄·2Na

InChI:InChI=1S/C8H6O4.2Na/c9-7(10)5-2-1-3-6(4-5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;

InChI key:InChIKey=JHYVMGFNRDCNNT-UHFFFAOYSA-N

SMILES:[Na].O=C(O)C1=CC=CC(=C1)C(=O)O