CAS 1002727-89-0
:4-(Phenoxymethyl)benzenesulfonyl chloride
Description:
4-(Phenoxymethyl)benzenesulfonyl chloride, identified by its CAS number 1002727-89-0, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a phenyl ring that is further substituted with a phenoxymethyl group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the sulfonyl chloride moiety, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, especially for the introduction of sulfonyl groups into various substrates. The presence of the phenoxymethyl group can influence its solubility and reactivity, often enhancing its ability to interact with nucleophiles. Additionally, this compound may exhibit properties such as stability under certain conditions, but it should be handled with care due to the potential for releasing hydrochloric acid upon hydrolysis. Overall, 4-(Phenoxymethyl)benzenesulfonyl chloride is a valuable intermediate in the synthesis of pharmaceuticals and other fine chemicals.
Formula:C13H11ClO3S
InChI:InChI=1S/C13H11ClO3S/c14-18(15,16)13-8-6-11(7-9-13)10-17-12-4-2-1-3-5-12/h1-9H,10H2
InChI key:InChIKey=ITLWVYCIZYWFNW-UHFFFAOYSA-N
SMILES:C(OC1=CC=CC=C1)C2=CC=C(S(Cl)(=O)=O)C=C2
Synonyms:- Benzenesulfonyl chloride, 4-(phenoxymethyl)-
- 4-(Phenoxymethyl)benzenesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
