CAS 1002727-90-3
:4-(2-Thienylmethyl)benzoic acid
Description:
4-(2-Thienylmethyl)benzoic acid is an organic compound characterized by its unique structure, which includes a benzoic acid moiety and a thienyl group. The thienyl group, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic rings. It may exhibit acidic behavior due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification or amidation. The presence of the thienyl group can also influence the compound's electronic properties, making it of interest in materials science and organic synthesis. Additionally, compounds with similar structures are often studied for their potential biological activities, including antimicrobial or anti-inflammatory properties. Overall, 4-(2-Thienylmethyl)benzoic acid serves as a versatile building block in organic chemistry and may have applications in pharmaceuticals and agrochemicals.
Formula:C12H10O2S
InChI:InChI=1S/C12H10O2S/c13-12(14)10-5-3-9(4-6-10)8-11-2-1-7-15-11/h1-7H,8H2,(H,13,14)
InChI key:InChIKey=OAIBKSRZDOMJKZ-UHFFFAOYSA-N
SMILES:C(C1=CC=C(C(O)=O)C=C1)C2=CC=CS2
Synonyms:- Benzoic acid, 4-(2-thienylmethyl)-
- CC 70601
- 4-(2-Thienylmethyl)benzoic acid
- 4-(Thien-2-ylmethyl)benzoic acid, 97%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
