CymitQuimica logo

CAS 1002752-54-6

:

(3S)-3-(3-Bromophenyl)-4-(4-chlorophenyl)-2-butanone

Description:
(3S)-3-(3-Bromophenyl)-4-(4-chlorophenyl)-2-butanone is an organic compound characterized by its specific stereochemistry and functional groups. It features a butanone backbone, which includes a ketone functional group, indicating that it has a carbonyl (C=O) group. The presence of bromine and chlorine substituents on the phenyl rings contributes to its reactivity and potential biological activity. The compound's stereochemistry, denoted by the (3S) configuration, suggests that it has a specific spatial arrangement of atoms, which can influence its interactions and properties. This compound may exhibit properties such as lipophilicity due to the aromatic rings, which can affect its solubility in organic solvents. Additionally, the halogen substituents can enhance its electrophilic character, making it a candidate for various chemical reactions. Overall, the unique combination of functional groups and stereochemistry makes this compound of interest in fields such as medicinal chemistry and materials science.
Formula:C16H14BrClO
InChI:InChI=1S/C16H14BrClO/c1-11(19)16(13-3-2-4-14(17)10-13)9-12-5-7-15(18)8-6-12/h2-8,10,16H,9H2,1H3/t16-/m1/s1
InChI key:InChIKey=UXWQKWNHXQZIND-MRXNPFEDSA-N
SMILES:[C@@H](CC1=CC=C(Cl)C=C1)(C(C)=O)C2=CC(Br)=CC=C2
Synonyms:
  • (S)-3-(3-Bromophenyl)-4-(4-chlorophenyl)butan-2-one
  • 2-Butanone, 3-(3-bromophenyl)-4-(4-chlorophenyl)-, (3S)-
  • (3S)-3-(3-Bromophenyl)-4-(4-chlorophenyl)butan-2-one
  • (3S)-3-(3-Bromophenyl)-4-(4-chlorophenyl)-2-butanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.