CAS 100278-52-2
:4-chloro-N-[4-(hydrazinylcarbonyl)phenyl]benzamide
Description:
4-Chloro-N-[4-(hydrazinylcarbonyl)phenyl]benzamide, with the CAS number 100278-52-2, is a chemical compound that features a benzamide structure substituted with a chloro group and a hydrazinylcarbonyl moiety. This compound typically exhibits characteristics common to amides, such as moderate solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amide functional group. The chloro substituent can influence its reactivity and polarity, while the hydrazinyl group may impart biological activity, making it of interest in medicinal chemistry. The presence of the hydrazine moiety suggests potential applications in the synthesis of other compounds or as a precursor in various chemical reactions. Additionally, the compound may exhibit specific spectral properties, such as UV-Vis and IR absorption characteristics, which can be utilized for analytical identification. Overall, this compound's unique structure may confer specific pharmacological properties, warranting further investigation in drug development and related fields.
Formula:C14H12ClN3O2
InChI:InChI=1/C14H12ClN3O2/c15-11-5-1-9(2-6-11)13(19)17-12-7-3-10(4-8-12)14(20)18-16/h1-8H,16H2,(H,17,19)(H,18,20)
SMILES:c1cc(ccc1C(=Nc1ccc(cc1)C(=O)NN)O)Cl
Synonyms:- Benzoic Acid, 4-[(4-Chlorobenzoyl)Amino]-, Hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.